C15H29N3OS — CID 71862994
1-[(1-propylpiperidin-4-yl)methyl]-3-(thian-3-yl)urea (PubChem CID 71862994) has the molecular formula C15H29N3OS and a molecular weight of 299.48 g/mol. Its IUPAC name is 1-[(1-propylpiperidin-4-yl)methyl]-3-(thian-3-yl)urea.
| Compound Name | 1-[(1-propylpiperidin-4-yl)methyl]-3-(thian-3-yl)urea |
|---|---|
| PubChem CID | 71862994 |
| Molecular Formula | C15H29N3OS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-[(1-propylpiperidin-4-yl)methyl]-3-(thian-3-yl)urea |
| SMILES | CCCN1CCC(CNC(=O)NC2CCCSC2)CC1 |
| InChI | InChI=1S/C15H29N3OS/c1-2-7-18-8-5-13(6-9-18)11-16-15(19)17-14-4-3-10-20-12-14/h13-14H,2-12H2,1H3,(H2,16,17,19) |
| InChIKey | LTTNVCCWMSZPPC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |