C8H17N3OS — CID 117234777
1-(2-aminoethyl)-3-(thian-3-yl)urea (PubChem CID 117234777) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(thian-3-yl)urea.
| Compound Name | 1-(2-aminoethyl)-3-(thian-3-yl)urea |
|---|---|
| PubChem CID | 117234777 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(2-aminoethyl)-3-(thian-3-yl)urea |
| SMILES | NCCNC(=O)NC1CCCSC1 |
| InChI | InChI=1S/C8H17N3OS/c9-3-4-10-8(12)11-7-2-1-5-13-6-7/h7H,1-6,9H2,(H2,10,11,12) |
| InChIKey | MHDHXKQJMORLKD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |