C11H19N3O4S — CID 113364258
(2S)-5-amino-5-oxo-2-(thian-3-ylcarbamoylamino)pentanoic acid (PubChem CID 113364258) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-(thian-3-ylcarbamoylamino)pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-(thian-3-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 113364258 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-(thian-3-ylcarbamoylamino)pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)NC1CCCSC1)C(=O)O |
| InChI | InChI=1S/C11H19N3O4S/c12-9(15)4-3-8(10(16)17)14-11(18)13-7-2-1-5-19-6-7/h7-8H,1-6H2,(H2,12,15)(H,16,17)(H2,13,14,18)/t7?,8-/m0/s1 |
| InChIKey | RGSIIAOPROSQRI-MQWKRIRWSA-N |
| XLogP | -0.10 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |