C35H47N5O3 — CID 139917007
N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-2-(piperidin-4-ylcarbamoylamino)-9H-xanthene-9-carboxamide (PubChem CID 139917007) has the molecular formula C35H47N5O3 and a molecular weight of 585.79 g/mol. Its IUPAC name is N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-2-(piperidin-4-ylcarbamoylamino)-9H-xanthene-9-carboxamide.
| Compound Name | N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-2-(piperidin-4-ylcarbamoylamino)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 139917007 |
| Molecular Formula | C35H47N5O3 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.37 |
| IUPAC Name | N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-2-(piperidin-4-ylcarbamoylamino)-9H-xanthene-9-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(C(=O)NC1CCN(C/C3=C/CCCCCCC3)CC1)c1ccccc1O2)NC1CCNCC1 |
| InChI | InChI=1S/C35H47N5O3/c41-34(37-27-17-21-40(22-18-27)24-25-9-5-3-1-2-4-6-10-25)33-29-11-7-8-12-31(29)43-32-14-13-28(23-30(32)33)39-35(42)38-26-15-19-36-20-16-26/h7-9,11-14,23,26-27,33,36H,1-6,10,15-22,24H2,(H,37,41)(H2,38,39,42)/b25-9+ |
| InChIKey | RQHOPZVNJBAZLB-YCPBAFNGSA-N |
| XLogP | 6.05 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|