C35H46N4O3 — CID 70133703
2-(4-aminopiperidine-1-carbonyl)-N-[1-(cyclononen-1-ylmethyl)piperidin-4-yl]-9H-xanthene-9-carboxamide (PubChem CID 70133703) has the molecular formula C35H46N4O3 and a molecular weight of 570.78 g/mol. Its IUPAC name is 2-(4-aminopiperidine-1-carbonyl)-N-[1-(cyclononen-1-ylmethyl)piperidin-4-yl]-9H-xanthene-9-carboxamide.
| Compound Name | 2-(4-aminopiperidine-1-carbonyl)-N-[1-(cyclononen-1-ylmethyl)piperidin-4-yl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 70133703 |
| Molecular Formula | C35H46N4O3 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | 2-(4-aminopiperidine-1-carbonyl)-N-[1-(cyclononen-1-ylmethyl)piperidin-4-yl]-9H-xanthene-9-carboxamide |
| SMILES | NC1CCN(C(=O)c2ccc3c(c2)C(C(=O)NC2CCN(CC4=CCCCCCCC4)CC2)c2ccccc2O3)CC1 |
| InChI | InChI=1S/C35H46N4O3/c36-27-15-21-39(22-16-27)35(41)26-13-14-32-30(23-26)33(29-11-7-8-12-31(29)42-32)34(40)37-28-17-19-38(20-18-28)24-25-9-5-3-1-2-4-6-10-25/h7-9,11-14,23,27-28,33H,1-6,10,15-22,24,36H2,(H,37,40) |
| InChIKey | PKBZKWKZAPAMTN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|