C33H44N4O3 — CID 139916997
2-N-(3-aminopropyl)-9-N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-9H-xanthene-2,9-dicarboxamide (PubChem CID 139916997) has the molecular formula C33H44N4O3 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2-N-(3-aminopropyl)-9-N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-9H-xanthene-2,9-dicarboxamide.
| Compound Name | 2-N-(3-aminopropyl)-9-N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-9H-xanthene-2,9-dicarboxamide |
|---|---|
| PubChem CID | 139916997 |
| Molecular Formula | C33H44N4O3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-N-(3-aminopropyl)-9-N-[1-[[(1E)-cyclononen-1-yl]methyl]piperidin-4-yl]-9H-xanthene-2,9-dicarboxamide |
| SMILES | NCCCNC(=O)c1ccc2c(c1)C(C(=O)NC1CCN(C/C3=C/CCCCCCC3)CC1)c1ccccc1O2 |
| InChI | InChI=1S/C33H44N4O3/c34-18-9-19-35-32(38)25-14-15-30-28(22-25)31(27-12-7-8-13-29(27)40-30)33(39)36-26-16-20-37(21-17-26)23-24-10-5-3-1-2-4-6-11-24/h7-8,10,12-15,22,26,31H,1-6,9,11,16-21,23,34H2,(H,35,38)(H,36,39)/b24-10+ |
| InChIKey | IMSHGQMAJYJINO-YSURURNPSA-N |
| XLogP | 5.25 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|