C27H25NO4 — CID 69147680
[(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl 9H-xanthen-9-yl carbonate (PubChem CID 69147680) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl 9H-xanthen-9-yl carbonate.
| Compound Name | [(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl 9H-xanthen-9-yl carbonate |
|---|---|
| PubChem CID | 69147680 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [(5R)-3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl 9H-xanthen-9-yl carbonate |
| SMILES | O=C(OCC1C2CN(Cc3ccccc3)C[C@@H]12)OC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C27H25NO4/c29-27(30-17-23-21-15-28(16-22(21)23)14-18-8-2-1-3-9-18)32-26-19-10-4-6-12-24(19)31-25-13-7-5-11-20(25)26/h1-13,21-23,26H,14-17H2/t21-,22?,23?/m1/s1 |
| InChIKey | ZZRZAKHISWLJMS-DDRJZQQSSA-N |
| XLogP | 5.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |