C20H20N2O3 — CID 140634241
2-[6-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methoxy]-3-pyridinyl]-2-oxoacetaldehyde (PubChem CID 140634241) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[6-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methoxy]-3-pyridinyl]-2-oxoacetaldehyde.
| Compound Name | 2-[6-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methoxy]-3-pyridinyl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 140634241 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[6-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methoxy]-3-pyridinyl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)c1ccc(OCC2C3CN(Cc4ccccc4)CC23)nc1 |
| InChI | InChI=1S/C20H20N2O3/c23-12-19(24)15-6-7-20(21-8-15)25-13-18-16-10-22(11-17(16)18)9-14-4-2-1-3-5-14/h1-8,12,16-18H,9-11,13H2 |
| InChIKey | FQLPZXJTUFPHGH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|