C26H26N2O3 — CID 69116729
(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl 2-hydroxy-2-phenyl-2-pyridin-2-ylacetate (PubChem CID 69116729) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl 2-hydroxy-2-phenyl-2-pyridin-2-ylacetate.
| Compound Name | (3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl 2-hydroxy-2-phenyl-2-pyridin-2-ylacetate |
|---|---|
| PubChem CID | 69116729 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl 2-hydroxy-2-phenyl-2-pyridin-2-ylacetate |
| SMILES | O=C(OCC1C2CN(Cc3ccccc3)CC12)C(O)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C26H26N2O3/c29-25(26(30,20-11-5-2-6-12-20)24-13-7-8-14-27-24)31-18-23-21-16-28(17-22(21)23)15-19-9-3-1-4-10-19/h1-14,21-23,30H,15-18H2 |
| InChIKey | FZNYVHFDWVEWMF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |