C23H25NO4 — CID 3964401
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 9H-xanthene-9-carboxylate (PubChem CID 3964401) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 9H-xanthene-9-carboxylate.
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 9H-xanthene-9-carboxylate |
|---|---|
| PubChem CID | 3964401 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 9H-xanthene-9-carboxylate |
| SMILES | CC1CC(C)CN(C(=O)COC(=O)C2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C23H25NO4/c1-15-11-16(2)13-24(12-15)21(25)14-27-23(26)22-17-7-3-5-9-19(17)28-20-10-6-4-8-18(20)22/h3-10,15-16,22H,11-14H2,1-2H3 |
| InChIKey | WDIOFAKYSRWICR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |