C40H41N5O6 — CID 86612397
benzyl (2S,3R)-3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxo-1-(phenylcarbamoyl)azetidine-2-carboxylate (PubChem CID 86612397) has the molecular formula C40H41N5O6 and a molecular weight of 687.80 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxo-1-(phenylcarbamoyl)azetidine-2-carboxylate.
| Compound Name | benzyl (2S,3R)-3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxo-1-(phenylcarbamoyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 86612397 |
| Molecular Formula | C40H41N5O6 |
| Molecular Weight | 687.80 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | benzyl (2S,3R)-3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxo-1-(phenylcarbamoyl)azetidine-2-carboxylate |
| SMILES | O=C(CCc1ccccc1)NC(=NCCC[C@H]1C(=O)N(C(=O)Nc2ccccc2)[C@@H]1C(=O)OCc1ccccc1)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C40H41N5O6/c46-34(25-23-29-14-5-1-6-15-29)43-39(44-35(47)26-24-30-16-7-2-8-17-30)41-27-13-22-33-36(38(49)51-28-31-18-9-3-10-19-31)45(37(33)48)40(50)42-32-20-11-4-12-21-32/h1-12,14-21,33,36H,13,22-28H2,(H,42,50)(H2,41,43,44,46,47)/t33-,36+/m1/s1 |
| InChIKey | ZIHFFGDVLJEMLK-ILFWFZRHSA-N |
| XLogP | 5.42 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|