C26H30N4O5 — CID 68602391
3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 68602391) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is 3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | 3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68602391 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 3-[3-[bis(3-phenylpropanoylamino)methylideneamino]propyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | O=C(CCc1ccccc1)NC(=NCCCC1C(=O)NC1C(=O)O)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H30N4O5/c31-21(15-13-18-8-3-1-4-9-18)28-26(29-22(32)16-14-19-10-5-2-6-11-19)27-17-7-12-20-23(25(34)35)30-24(20)33/h1-6,8-11,20,23H,7,12-17H2,(H,30,33)(H,34,35)(H2,27,28,29,31,32) |
| InChIKey | RMWBVWQYNCALMP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|