C31H34N4O7S — CID 20716051
phenyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2,2-dimethyl-4-oxoazetidine-1-sulfinate (PubChem CID 20716051) has the molecular formula C31H34N4O7S and a molecular weight of 606.70 g/mol. Its IUPAC name is phenyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2,2-dimethyl-4-oxoazetidine-1-sulfinate.
| Compound Name | phenyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2,2-dimethyl-4-oxoazetidine-1-sulfinate |
|---|---|
| PubChem CID | 20716051 |
| Molecular Formula | C31H34N4O7S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | phenyl 3-[3-[bis(phenylmethoxycarbonylamino)methylideneamino]propyl]-2,2-dimethyl-4-oxoazetidine-1-sulfinate |
| SMILES | CC1(C)C(CCCN=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)C(=O)N1S(=O)Oc1ccccc1 |
| InChI | InChI=1S/C31H34N4O7S/c1-31(2)26(27(36)35(31)43(39)42-25-17-10-5-11-18-25)19-12-20-32-28(33-29(37)40-21-23-13-6-3-7-14-23)34-30(38)41-22-24-15-8-4-9-16-24/h3-11,13-18,26H,12,19-22H2,1-2H3,(H2,32,33,34,37,38) |
| InChIKey | VPQSZICGQJFGKT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|