C25H27N7O11 — CID 173254644
3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylic acid (PubChem CID 173254644) has the molecular formula C25H27N7O11 and a molecular weight of 601.53 g/mol. Its IUPAC name is 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylic acid.
| Compound Name | 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 173254644 |
| Molecular Formula | C25H27N7O11 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylic acid |
| SMILES | NC(=NC(=O)OCc1ccc([N+](=O)[O-])cc1)N(CCCC(=O)NC1CN(C(=O)O)C1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H27N7O11/c26-22(28-23(34)42-14-16-3-7-19(8-4-16)31(38)39)30(11-1-2-21(33)27-18-12-29(13-18)24(35)36)25(37)43-15-17-5-9-20(10-6-17)32(40)41/h3-10,18H,1-2,11-15H2,(H,27,33)(H,35,36)(H2,26,28,34) |
| InChIKey | BLCDPAGOOTWGFF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 250.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|