C29H35N7O11 — CID 57029955
tert-butyl 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylate (PubChem CID 57029955) has the molecular formula C29H35N7O11 and a molecular weight of 657.64 g/mol. Its IUPAC name is tert-butyl 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 57029955 |
| Molecular Formula | C29H35N7O11 |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | tert-butyl 3-[4-[(4-nitrophenyl)methoxycarbonyl-[N'-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]butanoylamino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)CCCN(C(=O)OCc2ccc([N+](=O)[O-])cc2)C(N)=NC(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C29H35N7O11/c1-29(2,3)47-27(39)33-15-21(16-33)31-24(37)5-4-14-34(28(40)46-18-20-8-12-23(13-9-20)36(43)44)25(30)32-26(38)45-17-19-6-10-22(11-7-19)35(41)42/h6-13,21H,4-5,14-18H2,1-3H3,(H,31,37)(H2,30,32,38) |
| InChIKey | HCJSGOVUMIRARY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 239.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|