C26H28F3N7O12 — CID 18699886
(4-nitrophenyl)methyl N-[N'-[4-(azetidin-3-ylamino)-2-hydroxy-4-oxobutyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 18699886) has the molecular formula C26H28F3N7O12 and a molecular weight of 687.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[N'-[4-(azetidin-3-ylamino)-2-hydroxy-4-oxobutyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-nitrophenyl)methyl N-[N'-[4-(azetidin-3-ylamino)-2-hydroxy-4-oxobutyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18699886 |
| Molecular Formula | C26H28F3N7O12 |
| Molecular Weight | 687.54 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | (4-nitrophenyl)methyl N-[N'-[4-(azetidin-3-ylamino)-2-hydroxy-4-oxobutyl]-N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC(O)CN=C(NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC(=O)OCc1ccc([N+](=O)[O-])cc1)NC1CNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H27N7O10.C2HF3O2/c32-20(9-21(33)27-17-10-25-11-17)12-26-22(28-23(34)40-13-15-1-5-18(6-2-15)30(36)37)29-24(35)41-14-16-3-7-19(8-4-16)31(38)39;3-2(4,5)1(6)7/h1-8,17,20,25,32H,9-14H2,(H,27,33)(H2,26,28,29,34,35);(H,6,7) |
| InChIKey | HHGXLOFAURDRTH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 273.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|