C26H26F3N7O11 — CID 173254746
[(3S)-3-[[(2S)-2-[(4-nitrophenyl)methoxycarbonyl-[N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]propanoyl]amino]pyrrolidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 173254746) has the molecular formula C26H26F3N7O11 and a molecular weight of 669.53 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-[(4-nitrophenyl)methoxycarbonyl-[N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]propanoyl]amino]pyrrolidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S)-3-[[(2S)-2-[(4-nitrophenyl)methoxycarbonyl-[N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]propanoyl]amino]pyrrolidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173254746 |
| Molecular Formula | C26H26F3N7O11 |
| Molecular Weight | 669.53 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | [(3S)-3-[[(2S)-2-[(4-nitrophenyl)methoxycarbonyl-[N-[(4-nitrophenyl)methoxycarbonyl]carbamimidoyl]amino]propanoyl]amino]pyrrolidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccc([N+](=O)[O-])cc1)N(C(=O)OCc1ccc([N+](=O)[O-])cc1)[C@@H](C)C(=O)N[C@H]1CCN(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C26H26F3N7O11/c1-15(21(37)31-18-10-11-33(12-18)47-22(38)26(27,28)29)34(25(40)46-14-17-4-8-20(9-5-17)36(43)44)23(30)32-24(39)45-13-16-2-6-19(7-3-16)35(41)42/h2-9,15,18H,10-14H2,1H3,(H,31,37)(H2,30,32,39)/t15-,18-/m0/s1 |
| InChIKey | FHVLCGDZCYUAOZ-YJBOKZPZSA-N |
| XLogP | 2.90 |
| TPSA | 236.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|