C19H21F3N4O7 — CID 70100332
(4-nitrophenyl)methyl (2R)-2-[[(3S)-1-(2,2,2-trifluoroacetyl)oxypyrrolidin-3-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 70100332) has the molecular formula C19H21F3N4O7 and a molecular weight of 474.39 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-[[(3S)-1-(2,2,2-trifluoroacetyl)oxypyrrolidin-3-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R)-2-[[(3S)-1-(2,2,2-trifluoroacetyl)oxypyrrolidin-3-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70100332 |
| Molecular Formula | C19H21F3N4O7 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-[[(3S)-1-(2,2,2-trifluoroacetyl)oxypyrrolidin-3-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(N[C@H]1CCN(OC(=O)C(F)(F)F)C1)[C@H]1CCCN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21F3N4O7/c20-19(21,22)17(28)33-24-9-7-13(10-24)23-16(27)15-2-1-8-25(15)18(29)32-11-12-3-5-14(6-4-12)26(30)31/h3-6,13,15H,1-2,7-11H2,(H,23,27)/t13-,15+/m0/s1 |
| InChIKey | AEOLDUSESJMZAB-DZGCQCFKSA-N |
| XLogP | 1.91 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|