C15H17F3N2O7 — CID 66870406
(4-nitrophenyl)methyl (2R,5R)-5-hydroxypiperidine-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 66870406) has the molecular formula C15H17F3N2O7 and a molecular weight of 394.30 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,5R)-5-hydroxypiperidine-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-nitrophenyl)methyl (2R,5R)-5-hydroxypiperidine-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66870406 |
| Molecular Formula | C15H17F3N2O7 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,5R)-5-hydroxypiperidine-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCc1ccc([N+](=O)[O-])cc1)[C@H]1CC[C@@H](O)CN1 |
| InChI | InChI=1S/C13H16N2O5.C2HF3O2/c16-11-5-6-12(14-7-11)13(17)20-8-9-1-3-10(4-2-9)15(18)19;3-2(4,5)1(6)7/h1-4,11-12,14,16H,5-8H2;(H,6,7)/t11-,12-;/m1./s1 |
| InChIKey | YCYPQNSMLKQVGF-MNMPKAIFSA-N |
| XLogP | 1.38 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|