About (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate
(4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate (PubChem CID 66871344) has the molecular formula C20H21N3O5
and a molecular weight of 383.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate |
| PubChem CID | 66871344 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate |
| SMILES | O=C(N[C@H]1CC[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)NC1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O5/c24-19(15-4-2-1-3-5-15)22-16-8-11-18(21-12-16)20(25)28-13-14-6-9-17(10-7-14)23(26)27/h1-7,9-10,16,18,21H,8,11-13H2,(H,22,24)/t16-,18+/m0/s1 |
| InChIKey | PQVVYNMFFRRJCL-FUHWJXTLSA-N |
| XLogP | 2.19 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate?
The IUPAC name of (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate (CID 66871344) is (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate.
What is the SMILES notation for (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate?
The canonical SMILES for (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate is O=C(N[C@H]1CC[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)NC1)c1ccccc1.
What is the InChIKey of (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate?
The InChIKey is PQVVYNMFFRRJCL-FUHWJXTLSA-N. The full InChI is InChI=1S/C20H21N3O5/c24-19(15-4-2-1-3-5-15)22-16-8-11-18(21-12-16)20(25)28-13-14-6-9-17(10-7-14)23(26)27/h1-7,9-10,16,18,21H,8,11-13H2,(H,22,24)/t16-,18+/m0/s1.
What are the key properties of (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate?
(4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate has a molecular weight of 383.40 g/mol, XLogP of 2.19, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl (2R,5S)-5-benzamidopiperidine-2-carboxylate is sourced from PubChem (CID 66871344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).