C18H21N3O4S — CID 95551992
2-[(3S)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 95551992) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[(3S)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3S)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 95551992 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[(3S)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)[C@H]2CCCN(c3nc(C(N)=O)cs3)C2)cc1OC |
| InChI | InChI=1S/C18H21N3O4S/c1-24-14-6-5-11(8-15(14)25-2)16(22)12-4-3-7-21(9-12)18-20-13(10-26-18)17(19)23/h5-6,8,10,12H,3-4,7,9H2,1-2H3,(H2,19,23)/t12-/m0/s1 |
| InChIKey | HSTJTZSWLJNFRO-LBPRGKRZSA-N |
| XLogP | 2.36 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |