C22H23N3O3 — CID 95556864
(3,4-dimethoxyphenyl)-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]methanone (PubChem CID 95556864) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95556864 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]methanone |
| SMILES | COc1ccc(C(=O)[C@H]2CCCN(c3cnc4ccccc4n3)C2)cc1OC |
| InChI | InChI=1S/C22H23N3O3/c1-27-19-10-9-15(12-20(19)28-2)22(26)16-6-5-11-25(14-16)21-13-23-17-7-3-4-8-18(17)24-21/h3-4,7-10,12-13,16H,5-6,11,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | RLKPUWXRWXMIJZ-INIZCTEOSA-N |
| XLogP | 3.75 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |