C10H15N3S2 — CID 82514827
2-(azepan-1-yl)-1,3-thiazole-4-carbothioamide (PubChem CID 82514827) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1,3-thiazole-4-carbothioamide.
| Compound Name | 2-(azepan-1-yl)-1,3-thiazole-4-carbothioamide |
|---|---|
| PubChem CID | 82514827 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(azepan-1-yl)-1,3-thiazole-4-carbothioamide |
| SMILES | NC(=S)c1csc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C10H15N3S2/c11-9(14)8-7-15-10(12-8)13-5-3-1-2-4-6-13/h7H,1-6H2,(H2,11,14) |
| InChIKey | PFHBLJYTMPPKNB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|