2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid

C10H15N3O2S — CID 104527258

IUPAC2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid
SMILESNC(C(=O)O)c1csc(N2CCCCC2)n1
InChIInChI=1S/C10H15N3O2S/c11-8(9(14)15)7-6-16-10(12-7)13-4-2-1-3-5-13/h6,8H,1-5,11H2,(H,14,15)
InChIKeyYNWLOMYKUUFTIV-UHFFFAOYSA-N
MW241.32 g/mol
LogP1.22
Rot. Bonds3

About 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid

2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid (PubChem CID 104527258) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid
PubChem CID104527258
Molecular FormulaC10H15N3O2S
Molecular Weight241.32 g/mol
Exact Mass241.09
IUPAC Name2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid
SMILESNC(C(=O)O)c1csc(N2CCCCC2)n1
InChIInChI=1S/C10H15N3O2S/c11-8(9(14)15)7-6-16-10(12-7)13-4-2-1-3-5-13/h6,8H,1-5,11H2,(H,14,15)
InChIKeyYNWLOMYKUUFTIV-UHFFFAOYSA-N
XLogP1.22
TPSA79.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.32
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid (CID 104527258) is 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid is NC(C(=O)O)c1csc(N2CCCCC2)n1.
What is the InChIKey of 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid?
The InChIKey is YNWLOMYKUUFTIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c11-8(9(14)15)7-6-16-10(12-7)13-4-2-1-3-5-13/h6,8H,1-5,11H2,(H,14,15).
What are the key properties of 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid?
2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid has a molecular weight of 241.32 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(2-piperidin-1-yl-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 104527258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).