C14H22N4O2S — CID 104528021
2-amino-2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 104528021) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-amino-2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-amino-2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 104528021 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-amino-2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC1CN2CCCCC2CN1c1nc(C(N)C(=O)O)cs1 |
| InChI | InChI=1S/C14H22N4O2S/c1-9-6-17-5-3-2-4-10(17)7-18(9)14-16-11(8-21-14)12(15)13(19)20/h8-10,12H,2-7,15H2,1H3,(H,19,20) |
| InChIKey | MBXFJRJADNEKRJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |