C14H17N3O2S2 — CID 43778614
1,1-dioxo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thian-4-amine (PubChem CID 43778614) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1,1-dioxo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 43778614 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1,1-dioxo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2csc(-c3ccccn3)n2)CC1 |
| InChI | InChI=1S/C14H17N3O2S2/c18-21(19)7-4-11(5-8-21)16-9-12-10-20-14(17-12)13-3-1-2-6-15-13/h1-3,6,10-11,16H,4-5,7-9H2 |
| InChIKey | JSGVEULYXMIRJI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |