C26H23N3O2S — CID 108770790
(E)-3-(4-ethoxyphenyl)-2-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide (PubChem CID 108770790) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-2-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-2-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108770790 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-2-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C(/C(=O)NCc2csc(-c3ccccn3)n2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O2S/c1-2-31-22-13-11-19(12-14-22)16-23(20-8-4-3-5-9-20)25(30)28-17-21-18-32-26(29-21)24-10-6-7-15-27-24/h3-16,18H,2,17H2,1H3,(H,28,30)/b23-16+ |
| InChIKey | MFEJKCZCRGQBJK-XQNSMLJCSA-N |
| XLogP | 5.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|