C28H26N2O2S — CID 108760549
(E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-ethoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 108760549) has the molecular formula C28H26N2O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-ethoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-ethoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108760549 |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (E)-N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-3-(4-ethoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | CCOc1ccc(/C=C(/C(=O)NCc2csc(Cc3ccccc3)n2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2O2S/c1-2-32-25-15-13-22(14-16-25)17-26(23-11-7-4-8-12-23)28(31)29-19-24-20-33-27(30-24)18-21-9-5-3-6-10-21/h3-17,20H,2,18-19H2,1H3,(H,29,31)/b26-17+ |
| InChIKey | HOFRVPUBPRXIKA-YZSQISJMSA-N |
| XLogP | 5.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|