C15H11FIN3S — CID 79759320
4-fluoro-2-iodo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]aniline (PubChem CID 79759320) has the molecular formula C15H11FIN3S and a molecular weight of 411.24 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]aniline.
| Compound Name | 4-fluoro-2-iodo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 79759320 |
| Molecular Formula | C15H11FIN3S |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 4-fluoro-2-iodo-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]aniline |
| SMILES | Fc1ccc(NCc2csc(-c3ccccn3)n2)c(I)c1 |
| InChI | InChI=1S/C15H11FIN3S/c16-10-4-5-13(12(17)7-10)19-8-11-9-21-15(20-11)14-3-1-2-6-18-14/h1-7,9,19H,8H2 |
| InChIKey | RMYXPGXSWLTDHR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|