C17H25N3S — CID 78921085
N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]octan-1-amine (PubChem CID 78921085) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]octan-1-amine.
| Compound Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]octan-1-amine |
|---|---|
| PubChem CID | 78921085 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]octan-1-amine |
| SMILES | CCCCCCCCNCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H25N3S/c1-2-3-4-5-6-8-11-18-13-15-14-21-17(20-15)16-10-7-9-12-19-16/h7,9-10,12,14,18H,2-6,8,11,13H2,1H3 |
| InChIKey | QWNVLSCOCMGSNC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|