C13H11NOS — CID 79817698
4-(4-phenyl-1,3-thiazol-2-yl)but-2-yn-1-ol (PubChem CID 79817698) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-(4-phenyl-1,3-thiazol-2-yl)but-2-yn-1-ol.
| Compound Name | 4-(4-phenyl-1,3-thiazol-2-yl)but-2-yn-1-ol |
|---|---|
| PubChem CID | 79817698 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 4-(4-phenyl-1,3-thiazol-2-yl)but-2-yn-1-ol |
| SMILES | OCC#CCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H11NOS/c15-9-5-4-8-13-14-12(10-16-13)11-6-2-1-3-7-11/h1-3,6-7,10,15H,8-9H2 |
| InChIKey | KIAXMFQQZBWQTD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|