C17H12ClN5S — CID 95560849
4-(4-chlorophenyl)-2-phenyl-5-(2H-tetrazol-5-ylmethyl)-1,3-thiazole (PubChem CID 95560849) has the molecular formula C17H12ClN5S and a molecular weight of 353.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-phenyl-5-(2H-tetrazol-5-ylmethyl)-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-2-phenyl-5-(2H-tetrazol-5-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 95560849 |
| Molecular Formula | C17H12ClN5S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-(4-chlorophenyl)-2-phenyl-5-(2H-tetrazol-5-ylmethyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)sc2Cc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C17H12ClN5S/c18-13-8-6-11(7-9-13)16-14(10-15-20-22-23-21-15)24-17(19-16)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,21,22,23) |
| InChIKey | FDCPQBCMKZQYIP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |