C11H8ClN5S — CID 3043282
2-(4-chlorophenyl)-4-(2H-tetrazol-5-ylmethyl)-1,3-thiazole (PubChem CID 3043282) has the molecular formula C11H8ClN5S and a molecular weight of 277.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2H-tetrazol-5-ylmethyl)-1,3-thiazole.
| Compound Name | 2-(4-chlorophenyl)-4-(2H-tetrazol-5-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 3043282 |
| Molecular Formula | C11H8ClN5S |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2H-tetrazol-5-ylmethyl)-1,3-thiazole |
| SMILES | Clc1ccc(-c2nc(Cc3nn[nH]n3)cs2)cc1 |
| InChI | InChI=1S/C11H8ClN5S/c12-8-3-1-7(2-4-8)11-13-9(6-18-11)5-10-14-16-17-15-10/h1-4,6H,5H2,(H,14,15,16,17) |
| InChIKey | ONIIRTRFVKBWNO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |