C17H11Cl2NO2S — CID 159765786
2-[2-(2,4-dichlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 159765786) has the molecular formula C17H11Cl2NO2S and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 159765786 |
| Molecular Formula | C17H11Cl2NO2S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(-c2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H11Cl2NO2S/c18-11-6-7-12(13(19)8-11)17-20-16(10-4-2-1-3-5-10)14(23-17)9-15(21)22/h1-8H,9H2,(H,21,22) |
| InChIKey | NFMCAQNATYCMBR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |