C19H15Cl2N3O2S — CID 24509189
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(2,4-dichloro-6-methyl-3-pyridinyl)acetamide (PubChem CID 24509189) has the molecular formula C19H15Cl2N3O2S and a molecular weight of 420.32 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(2,4-dichloro-6-methyl-3-pyridinyl)acetamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(2,4-dichloro-6-methyl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 24509189 |
| Molecular Formula | C19H15Cl2N3O2S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-(2,4-dichloro-6-methyl-3-pyridinyl)acetamide |
| SMILES | CC(=O)c1sc(NC(=O)Cc2c(Cl)cc(C)nc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H15Cl2N3O2S/c1-10-8-14(20)13(18(21)22-10)9-15(26)23-19-24-16(17(27-19)11(2)25)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,23,24,26) |
| InChIKey | GIWCGWMARGFHRW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|