C20H18N4O2S — CID 163703702
N-(1-aminoethylidene)-4-phenyl-2-[(2-phenylacetyl)amino]-1,3-thiazole-5-carboxamide (PubChem CID 163703702) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(1-aminoethylidene)-4-phenyl-2-[(2-phenylacetyl)amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-aminoethylidene)-4-phenyl-2-[(2-phenylacetyl)amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 163703702 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(1-aminoethylidene)-4-phenyl-2-[(2-phenylacetyl)amino]-1,3-thiazole-5-carboxamide |
| SMILES | C/C(N)=N\C(=O)c1sc(NC(=O)Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N4O2S/c1-13(21)22-19(26)18-17(15-10-6-3-7-11-15)24-20(27-18)23-16(25)12-14-8-4-2-5-9-14/h2-11H,12H2,1H3,(H2,21,22,26)(H,23,24,25) |
| InChIKey | KDFHHPRDBIXBPI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|