C19H18ClN3OS2 — CID 100552715
4-(4-chlorophenyl)sulfanyl-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 100552715) has the molecular formula C19H18ClN3OS2 and a molecular weight of 403.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 100552715 |
| Molecular Formula | C19H18ClN3OS2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)CCCSc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C19H18ClN3OS2/c1-13-4-6-14(7-5-13)18-22-23-19(26-18)21-17(24)3-2-12-25-16-10-8-15(20)9-11-16/h4-11H,2-3,12H2,1H3,(H,21,23,24) |
| InChIKey | IQORSBXCCMRVFT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|