C19H18ClN3OS — CID 100502315
N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-ethylphenyl)propanamide (PubChem CID 100502315) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-ethylphenyl)propanamide.
| Compound Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 100502315 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(CCC(=O)Nc2nnc(-c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-2-13-3-5-14(6-4-13)7-12-17(24)21-19-23-22-18(25-19)15-8-10-16(20)11-9-15/h3-6,8-11H,2,7,12H2,1H3,(H,21,23,24) |
| InChIKey | NFNIVCDANKVVBW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |