C18H16N2O3S2 — CID 41085947
N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-phenylsulfanylbutanamide (PubChem CID 41085947) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-phenylsulfanylbutanamide.
| Compound Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 41085947 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C18H16N2O3S2/c21-17(7-4-8-24-12-5-2-1-3-6-12)20-18-19-13-9-14-15(23-11-22-14)10-16(13)25-18/h1-3,5-6,9-10H,4,7-8,11H2,(H,19,20,21) |
| InChIKey | PXTGBMHIVVZXHB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|