C18H17ClN2O2S — CID 19218842
4-(4-chlorophenoxy)-N-(4-methyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 19218842) has the molecular formula C18H17ClN2O2S and a molecular weight of 360.87 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(4-methyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-(4-methyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19218842 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(4-methyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | Cc1cccc2sc(NC(=O)CCCOc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C18H17ClN2O2S/c1-12-4-2-5-15-17(12)21-18(24-15)20-16(22)6-3-11-23-14-9-7-13(19)8-10-14/h2,4-5,7-10H,3,6,11H2,1H3,(H,20,21,22) |
| InChIKey | GNHVBRSLVQGKHR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|