C20H22N2O2S — CID 19218735
N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-4-(3-methylphenoxy)butanamide (PubChem CID 19218735) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-4-(3-methylphenoxy)butanamide.
| Compound Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-4-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 19218735 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-4-(3-methylphenoxy)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)Nc2nc3c(C)c(C)ccc3s2)c1 |
| InChI | InChI=1S/C20H22N2O2S/c1-13-6-4-7-16(12-13)24-11-5-8-18(23)21-20-22-19-15(3)14(2)9-10-17(19)25-20/h4,6-7,9-10,12H,5,8,11H2,1-3H3,(H,21,22,23) |
| InChIKey | FDQJCTOOTOPEJW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|