C26H21N5O3S2 — CID 4294054
4-[bis(2-cyanoethyl)sulfamoyl]-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide (PubChem CID 4294054) has the molecular formula C26H21N5O3S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide |
|---|---|
| PubChem CID | 4294054 |
| Molecular Formula | C26H21N5O3S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(cc4c5c(cccc53)CC4)s2)cc1 |
| InChI | InChI=1S/C26H21N5O3S2/c27-12-2-14-31(15-3-13-28)36(33,34)20-10-8-18(9-11-20)25(32)30-26-29-24-21-5-1-4-17-6-7-19(23(17)21)16-22(24)35-26/h1,4-5,8-11,16H,2-3,6-7,14-15H2,(H,29,30,32) |
| InChIKey | DBRDLHVIKFRBJZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |