C27H27N3O3S2 — CID 27602410
4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide (PubChem CID 27602410) has the molecular formula C27H27N3O3S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide.
| Compound Name | 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide |
|---|---|
| PubChem CID | 27602410 |
| Molecular Formula | C27H27N3O3S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)benzamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)Nc3nc4c(cc5c6c(cccc64)CC5)s3)cc2)C1 |
| InChI | InChI=1S/C27H27N3O3S2/c1-16-12-17(2)15-30(14-16)35(32,33)21-10-8-19(9-11-21)26(31)29-27-28-25-22-5-3-4-18-6-7-20(24(18)22)13-23(25)34-27/h3-5,8-11,13,16-17H,6-7,12,14-15H2,1-2H3,(H,28,29,31)/t16-,17+ |
| InChIKey | MKWDOXZIKHWIKI-CALCHBBNSA-N |
| XLogP | 5.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |