C28H23N5O3S2 — CID 5140057
4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,5-diphenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 5140057) has the molecular formula C28H23N5O3S2 and a molecular weight of 541.66 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,5-diphenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,5-diphenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 5140057 |
| Molecular Formula | C28H23N5O3S2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(4,5-diphenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C28H23N5O3S2/c29-17-7-19-33(20-8-18-30)38(35,36)24-15-13-23(14-16-24)27(34)32-28-31-25(21-9-3-1-4-10-21)26(37-28)22-11-5-2-6-12-22/h1-6,9-16H,7-8,19-20H2,(H,31,32,34) |
| InChIKey | RCTKFHSGTWXVQF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |