C16H19N3O2S2 — CID 8684457
1-(2-methylphenyl)-3-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 8684457) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8684457 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(1S)-1-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | Cc1ccccc1NC(=S)N[C@@H](C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-11-5-3-4-6-15(11)19-16(22)18-12(2)13-7-9-14(10-8-13)23(17,20)21/h3-10,12H,1-2H3,(H2,17,20,21)(H2,18,19,22)/t12-/m0/s1 |
| InChIKey | XZTKGSWIELIXCP-LBPRGKRZSA-N |
| XLogP | 2.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|