C16H19N3O2S2 — CID 19649491
1-(1-phenylethyl)-3-[(4-sulfamoylphenyl)methyl]thiourea (PubChem CID 19649491) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-[(4-sulfamoylphenyl)methyl]thiourea.
| Compound Name | 1-(1-phenylethyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 19649491 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(1-phenylethyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
| SMILES | CC(NC(=S)NCc1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-12(14-5-3-2-4-6-14)19-16(22)18-11-13-7-9-15(10-8-13)23(17,20)21/h2-10,12H,11H2,1H3,(H2,17,20,21)(H2,18,19,22) |
| InChIKey | HRBCFZWREVUVHV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|