C18H19N5O3S — CID 55746519
1-(3-pyrazol-1-ylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 55746519) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-(3-pyrazol-1-ylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(3-pyrazol-1-ylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55746519 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(3-pyrazol-1-ylphenyl)-3-[1-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1cccc(-n2cccn2)c1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c1-13(14-6-8-17(9-7-14)27(19,25)26)21-18(24)22-15-4-2-5-16(12-15)23-11-3-10-20-23/h2-13H,1H3,(H2,19,25,26)(H2,21,22,24) |
| InChIKey | JEJSZSOHIPBRBO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |