C19H20N4O4S2 — CID 56567767
1-[1-(4-sulfamoylphenyl)ethyl]-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea (PubChem CID 56567767) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[1-(4-sulfamoylphenyl)ethyl]-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea.
| Compound Name | 1-[1-(4-sulfamoylphenyl)ethyl]-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 56567767 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 1-[1-(4-sulfamoylphenyl)ethyl]-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea |
| SMILES | CC(NC(=O)Nc1cccc(OCc2cscn2)c1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20N4O4S2/c1-13(14-5-7-18(8-6-14)29(20,25)26)22-19(24)23-15-3-2-4-17(9-15)27-10-16-11-28-12-21-16/h2-9,11-13H,10H2,1H3,(H2,20,25,26)(H2,22,23,24) |
| InChIKey | JNSZHCSRCGSFQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |