C19H19N3O4S2 — CID 45281533
N-[1-(4-sulfamoylphenyl)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 45281533) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[1-(4-sulfamoylphenyl)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[1-(4-sulfamoylphenyl)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 45281533 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[1-(4-sulfamoylphenyl)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | CC(NC(=O)c1ccc(OCc2cscn2)cc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-13(14-4-8-18(9-5-14)28(20,24)25)22-19(23)15-2-6-17(7-3-15)26-10-16-11-27-12-21-16/h2-9,11-13H,10H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | ZGDIUOUDWAZLKH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |