C18H24N2O3S — CID 111477987
N-(2-hydroxy-2,3-dimethylpentyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 111477987) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylpentyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylpentyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 111477987 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylpentyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | CCC(C)C(C)(O)CNC(=O)c1ccc(OCc2cscn2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-4-13(2)18(3,22)11-19-17(21)14-5-7-16(8-6-14)23-9-15-10-24-12-20-15/h5-8,10,12-13,22H,4,9,11H2,1-3H3,(H,19,21) |
| InChIKey | ZLROMFXFALMYIF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |